C20H17BrN4OS — CID 168613251
benzyl N'-[[3-[(5-bromo-2-pyridinyl)oxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613251) has the molecular formula C20H17BrN4OS and a molecular weight of 441.35 g/mol. Its IUPAC name is benzyl N'-[[3-[(5-bromo-2-pyridinyl)oxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-[(5-bromo-2-pyridinyl)oxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613251 |
| Molecular Formula | C20H17BrN4OS |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | benzyl N'-[[3-[(5-bromo-2-pyridinyl)oxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cccc(Oc2ccc(Br)cn2)c1)SCc1ccccc1 |
| InChI | InChI=1S/C20H17BrN4OS/c21-17-9-10-19(23-13-17)26-18-8-4-7-16(11-18)12-24-25-20(22)27-14-15-5-2-1-3-6-15/h1-13H,14H2,(H2,22,25) |
| InChIKey | IOPIYDGLLAXXAN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|