C10H9N5OS — CID 168535172
[[3-(1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]thiourea (PubChem CID 168535172) has the molecular formula C10H9N5OS and a molecular weight of 247.28 g/mol. Its IUPAC name is [[3-(1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]thiourea.
| Compound Name | [[3-(1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535172 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | [[3-(1,2,4-oxadiazol-3-yl)phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cccc(-c2ncon2)c1 |
| InChI | InChI=1S/C10H9N5OS/c11-10(17)14-13-5-7-2-1-3-8(4-7)9-12-6-16-15-9/h1-6H,(H3,11,14,17) |
| InChIKey | AGSCKAHBWYJMQI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|