C9H9N3O2S — CID 71395516
3-[(carbamothioylhydrazinylidene)methyl]benzoic acid (PubChem CID 71395516) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is 3-[(carbamothioylhydrazinylidene)methyl]benzoic acid.
| Compound Name | 3-[(carbamothioylhydrazinylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 71395516 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 3-[(carbamothioylhydrazinylidene)methyl]benzoic acid |
| SMILES | NC(=S)NN=Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C9H9N3O2S/c10-9(15)12-11-5-6-2-1-3-7(4-6)8(13)14/h1-5H,(H,13,14)(H3,10,12,15) |
| InChIKey | QJVYIAVPHNELIT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|