C16H11IN2O8 — CID 146663056
bis(2,5-dioxopyrrolidin-1-yl) 5-iodobenzene-1,3-dicarboxylate (PubChem CID 146663056) has the molecular formula C16H11IN2O8 and a molecular weight of 486.17 g/mol. Its IUPAC name is bis(2,5-dioxopyrrolidin-1-yl) 5-iodobenzene-1,3-dicarboxylate.
| Compound Name | bis(2,5-dioxopyrrolidin-1-yl) 5-iodobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146663056 |
| Molecular Formula | C16H11IN2O8 |
| Molecular Weight | 486.17 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) 5-iodobenzene-1,3-dicarboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cc(I)cc(C(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C16H11IN2O8/c17-10-6-8(15(24)26-18-11(20)1-2-12(18)21)5-9(7-10)16(25)27-19-13(22)3-4-14(19)23/h5-7H,1-4H2 |
| InChIKey | XLLDBQZSSYROGD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|