C11H7ClFNO4 — CID 155923584
(2,5-dioxopyrrolidin-1-yl) 3-chloro-5-fluorobenzoate (PubChem CID 155923584) has the molecular formula C11H7ClFNO4 and a molecular weight of 271.63 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-chloro-5-fluorobenzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-chloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 155923584 |
| Molecular Formula | C11H7ClFNO4 |
| Molecular Weight | 271.63 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-chloro-5-fluorobenzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C11H7ClFNO4/c12-7-3-6(4-8(13)5-7)11(17)18-14-9(15)1-2-10(14)16/h3-5H,1-2H2 |
| InChIKey | KDCHUMPBAACDBG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.63 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|