C13H10F4N2O5 — CID 102479905
(2,5-dioxopyrrolidin-1-yl) 4-fluoro-3-[(2,2,2-trifluoro-1-hydroxyethyl)amino]benzoate (PubChem CID 102479905) has the molecular formula C13H10F4N2O5 and a molecular weight of 350.22 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-fluoro-3-[(2,2,2-trifluoro-1-hydroxyethyl)amino]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-fluoro-3-[(2,2,2-trifluoro-1-hydroxyethyl)amino]benzoate |
|---|---|
| PubChem CID | 102479905 |
| Molecular Formula | C13H10F4N2O5 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-fluoro-3-[(2,2,2-trifluoro-1-hydroxyethyl)amino]benzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(F)c(NC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F4N2O5/c14-7-2-1-6(5-8(7)18-12(23)13(15,16)17)11(22)24-19-9(20)3-4-10(19)21/h1-2,5,12,18,23H,3-4H2 |
| InChIKey | HBESBINDPQHGDZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|