C12H9F3N2O5 — CID 87557953
(2,5-dioxopyrrolidin-1-yl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate (PubChem CID 87557953) has the molecular formula C12H9F3N2O5 and a molecular weight of 318.21 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 87557953 |
| Molecular Formula | C12H9F3N2O5 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C12H9F3N2O5/c13-12(14,15)6-21-8-2-1-7(5-16-8)11(20)22-17-9(18)3-4-10(17)19/h1-2,5H,3-4,6H2 |
| InChIKey | HNCOSKHGYYABQY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|