C16H11F6N3O4 — CID 2746140
[[amino-[4-(trifluoromethoxy)phenyl]methylidene]amino] 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate (PubChem CID 2746140) has the molecular formula C16H11F6N3O4 and a molecular weight of 423.27 g/mol. Its IUPAC name is [[amino-[4-(trifluoromethoxy)phenyl]methylidene]amino] 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate.
| Compound Name | [[amino-[4-(trifluoromethoxy)phenyl]methylidene]amino] 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2746140 |
| Molecular Formula | C16H11F6N3O4 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | [[amino-[4-(trifluoromethoxy)phenyl]methylidene]amino] 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
| SMILES | NC(=NOC(=O)c1ccc(OCC(F)(F)F)nc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F6N3O4/c17-15(18,19)8-27-12-6-3-10(7-24-12)14(26)29-25-13(23)9-1-4-11(5-2-9)28-16(20,21)22/h1-7H,8H2,(H2,23,25) |
| InChIKey | MYDDAVKOLVJIIS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|