C17H14BrF3N2O4 — CID 73258651
[[amino-[4-(trifluoromethoxy)phenyl]methylidene]amino] 2-(4-bromo-3-methylphenoxy)acetate (PubChem CID 73258651) has the molecular formula C17H14BrF3N2O4 and a molecular weight of 447.21 g/mol. Its IUPAC name is [[amino-[4-(trifluoromethoxy)phenyl]methylidene]amino] 2-(4-bromo-3-methylphenoxy)acetate.
| Compound Name | [[amino-[4-(trifluoromethoxy)phenyl]methylidene]amino] 2-(4-bromo-3-methylphenoxy)acetate |
|---|---|
| PubChem CID | 73258651 |
| Molecular Formula | C17H14BrF3N2O4 |
| Molecular Weight | 447.21 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | [[amino-[4-(trifluoromethoxy)phenyl]methylidene]amino] 2-(4-bromo-3-methylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)ON=C(N)c2ccc(OC(F)(F)F)cc2)ccc1Br |
| InChI | InChI=1S/C17H14BrF3N2O4/c1-10-8-13(6-7-14(10)18)25-9-15(24)27-23-16(22)11-2-4-12(5-3-11)26-17(19,20)21/h2-8H,9H2,1H3,(H2,22,23) |
| InChIKey | SFALYJCVYKTTPT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|