C16H17N3O3 — CID 2914533
[[amino(pyridin-3-yl)methylidene]amino] 2-(3,4-dimethylphenoxy)acetate (PubChem CID 2914533) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is [[amino(pyridin-3-yl)methylidene]amino] 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | [[amino(pyridin-3-yl)methylidene]amino] 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 2914533 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [[amino(pyridin-3-yl)methylidene]amino] 2-(3,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)ON=C(N)c2cccnc2)cc1C |
| InChI | InChI=1S/C16H17N3O3/c1-11-5-6-14(8-12(11)2)21-10-15(20)22-19-16(17)13-4-3-7-18-9-13/h3-9H,10H2,1-2H3,(H2,17,19) |
| InChIKey | FKQHYBALXCFUMH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|