About [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate
[(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate (PubChem CID 5348619) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate |
| PubChem CID | 5348619 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate |
| SMILES | N/C(=N\OC(=O)CCc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C15H15N3O2/c16-15(13-7-4-10-17-11-13)18-20-14(19)9-8-12-5-2-1-3-6-12/h1-7,10-11H,8-9H2,(H2,16,18) |
| InChIKey | ZEGMGFAQFOIQFM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate?
The IUPAC name of [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate (CID 5348619) is [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate.
What is the SMILES notation for [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate?
The canonical SMILES for [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate is N/C(=N\OC(=O)CCc1ccccc1)c1cccnc1.
What is the InChIKey of [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate?
The InChIKey is ZEGMGFAQFOIQFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c16-15(13-7-4-10-17-11-13)18-20-14(19)9-8-12-5-2-1-3-6-12/h1-7,10-11H,8-9H2,(H2,16,18).
What are the key properties of [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate?
[(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate has a molecular weight of 269.30 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino(pyridin-3-yl)methylidene]amino] 3-phenylpropanoate is sourced from PubChem (CID 5348619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).