About [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate
[[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate (PubChem CID 2935904) has the molecular formula C14H12N4O4
and a molecular weight of 300.27 g/mol. Its IUPAC name is [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate.
Molecular Properties
| Compound Name | [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate |
| PubChem CID | 2935904 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate |
| SMILES | NC(=NOC(=O)Cc1ccccc1[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C14H12N4O4/c15-14(11-5-3-7-16-9-11)17-22-13(19)8-10-4-1-2-6-12(10)18(20)21/h1-7,9H,8H2,(H2,15,17) |
| InChIKey | ZNIFCGNLDPWOHO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate?
The IUPAC name of [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate (CID 2935904) is [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate.
What is the SMILES notation for [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate?
The canonical SMILES for [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate is NC(=NOC(=O)Cc1ccccc1[N+](=O)[O-])c1cccnc1.
What is the InChIKey of [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate?
The InChIKey is ZNIFCGNLDPWOHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O4/c15-14(11-5-3-7-16-9-11)17-22-13(19)8-10-4-1-2-6-12(10)18(20)21/h1-7,9H,8H2,(H2,15,17).
What are the key properties of [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate?
[[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate has a molecular weight of 300.27 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino(pyridin-3-yl)methylidene]amino] 2-(2-nitrophenyl)acetate is sourced from PubChem (CID 2935904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).