C23H26N4O3 — CID 69392633
2-phenylacetamide;3-phenylpropanamide;pyridine-3-carboxamide (PubChem CID 69392633) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-phenylacetamide;3-phenylpropanamide;pyridine-3-carboxamide.
| Compound Name | 2-phenylacetamide;3-phenylpropanamide;pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69392633 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-phenylacetamide;3-phenylpropanamide;pyridine-3-carboxamide |
| SMILES | NC(=O)CCc1ccccc1.NC(=O)Cc1ccccc1.NC(=O)c1cccnc1 |
| InChI | InChI=1S/C9H11NO.C8H9NO.C6H6N2O/c10-9(11)7-6-8-4-2-1-3-5-8;9-8(10)6-7-4-2-1-3-5-7;7-6(9)5-2-1-3-8-4-5/h1-5H,6-7H2,(H2,10,11);1-5H,6H2,(H2,9,10);1-4H,(H2,7,9) |
| InChIKey | BTLDNAGJBPGIJI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |