About potassium;ethene;pyridine-3-carboxamide
potassium;ethene;pyridine-3-carboxamide (PubChem CID 174767244) has the molecular formula C8H9KN2O
and a molecular weight of 188.27 g/mol. Its IUPAC name is potassium;ethene;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | potassium;ethene;pyridine-3-carboxamide |
| PubChem CID | 174767244 |
| Molecular Formula | C8H9KN2O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | potassium;ethene;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.[H][C-]=C.[K+] |
| InChI | InChI=1S/C6H6N2O.C2H3.K/c7-6(9)5-2-1-3-8-4-5;1-2;/h1-4H,(H2,7,9);1H,2H2;/q;-1;+1 |
| InChIKey | FRBHNHDENGSMOC-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;ethene;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethene;pyridine-3-carboxamide?
The IUPAC name of potassium;ethene;pyridine-3-carboxamide (CID 174767244) is potassium;ethene;pyridine-3-carboxamide.
What is the SMILES notation for potassium;ethene;pyridine-3-carboxamide?
The canonical SMILES for potassium;ethene;pyridine-3-carboxamide is NC(=O)c1cccnc1.[H][C-]=C.[K+].
What is the InChIKey of potassium;ethene;pyridine-3-carboxamide?
The InChIKey is FRBHNHDENGSMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C2H3.K/c7-6(9)5-2-1-3-8-4-5;1-2;/h1-4H,(H2,7,9);1H,2H2;/q;-1;+1.
What are the key properties of potassium;ethene;pyridine-3-carboxamide?
potassium;ethene;pyridine-3-carboxamide has a molecular weight of 188.27 g/mol, XLogP of -2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethene;pyridine-3-carboxamide is sourced from PubChem (CID 174767244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).