About 2-phenylacetamide;pyridine
2-phenylacetamide;pyridine (PubChem CID 22283001) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-phenylacetamide;pyridine.
Molecular Properties
| Compound Name | 2-phenylacetamide;pyridine |
| PubChem CID | 22283001 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-phenylacetamide;pyridine |
| SMILES | NC(=O)Cc1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C8H9NO.C5H5N/c9-8(10)6-7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H,6H2,(H2,9,10);1-5H |
| InChIKey | KDSSGCYYRGDTFG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylacetamide;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylacetamide;pyridine?
The IUPAC name of 2-phenylacetamide;pyridine (CID 22283001) is 2-phenylacetamide;pyridine.
What is the SMILES notation for 2-phenylacetamide;pyridine?
The canonical SMILES for 2-phenylacetamide;pyridine is NC(=O)Cc1ccccc1.c1ccncc1.
What is the InChIKey of 2-phenylacetamide;pyridine?
The InChIKey is KDSSGCYYRGDTFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C5H5N/c9-8(10)6-7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H,6H2,(H2,9,10);1-5H.
What are the key properties of 2-phenylacetamide;pyridine?
2-phenylacetamide;pyridine has a molecular weight of 214.27 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylacetamide;pyridine is sourced from PubChem (CID 22283001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).