About methyl 2-phenylacetate;pyridine
methyl 2-phenylacetate;pyridine (PubChem CID 22282999) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl 2-phenylacetate;pyridine.
Molecular Properties
| Compound Name | methyl 2-phenylacetate;pyridine |
| PubChem CID | 22282999 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | methyl 2-phenylacetate;pyridine |
| SMILES | COC(=O)Cc1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C9H10O2.C5H5N/c1-11-9(10)7-8-5-3-2-4-6-8;1-2-4-6-5-3-1/h2-6H,7H2,1H3;1-5H |
| InChIKey | ODLDGZPXIZTEEZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-phenylacetate;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phenylacetate;pyridine?
The IUPAC name of methyl 2-phenylacetate;pyridine (CID 22282999) is methyl 2-phenylacetate;pyridine.
What is the SMILES notation for methyl 2-phenylacetate;pyridine?
The canonical SMILES for methyl 2-phenylacetate;pyridine is COC(=O)Cc1ccccc1.c1ccncc1.
What is the InChIKey of methyl 2-phenylacetate;pyridine?
The InChIKey is ODLDGZPXIZTEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C5H5N/c1-11-9(10)7-8-5-3-2-4-6-8;1-2-4-6-5-3-1/h2-6H,7H2,1H3;1-5H.
What are the key properties of methyl 2-phenylacetate;pyridine?
methyl 2-phenylacetate;pyridine has a molecular weight of 229.28 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenylacetate;pyridine is sourced from PubChem (CID 22282999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).