About bis(benzenecarbothioic S-acid);methyl 2-phenylacetate
bis(benzenecarbothioic S-acid);methyl 2-phenylacetate (PubChem CID 87890916) has the molecular formula C23H22O4S2
and a molecular weight of 426.56 g/mol. Its IUPAC name is bis(benzenecarbothioic S-acid);methyl 2-phenylacetate.
Molecular Properties
| Compound Name | bis(benzenecarbothioic S-acid);methyl 2-phenylacetate |
| PubChem CID | 87890916 |
| Molecular Formula | C23H22O4S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | bis(benzenecarbothioic S-acid);methyl 2-phenylacetate |
| SMILES | COC(=O)Cc1ccccc1.O=C(S)c1ccccc1.O=C(S)c1ccccc1 |
| InChI | InChI=1S/C9H10O2.2C7H6OS/c1-11-9(10)7-8-5-3-2-4-6-8;2*8-7(9)6-4-2-1-3-5-6/h2-6H,7H2,1H3;2*1-5H,(H,8,9) |
| InChIKey | DCRSTLIIMCJDKW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(benzenecarbothioic S-acid);methyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzenecarbothioic S-acid);methyl 2-phenylacetate?
The IUPAC name of bis(benzenecarbothioic S-acid);methyl 2-phenylacetate (CID 87890916) is bis(benzenecarbothioic S-acid);methyl 2-phenylacetate.
What is the SMILES notation for bis(benzenecarbothioic S-acid);methyl 2-phenylacetate?
The canonical SMILES for bis(benzenecarbothioic S-acid);methyl 2-phenylacetate is COC(=O)Cc1ccccc1.O=C(S)c1ccccc1.O=C(S)c1ccccc1.
What is the InChIKey of bis(benzenecarbothioic S-acid);methyl 2-phenylacetate?
The InChIKey is DCRSTLIIMCJDKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.2C7H6OS/c1-11-9(10)7-8-5-3-2-4-6-8;2*8-7(9)6-4-2-1-3-5-6/h2-6H,7H2,1H3;2*1-5H,(H,8,9).
What are the key properties of bis(benzenecarbothioic S-acid);methyl 2-phenylacetate?
bis(benzenecarbothioic S-acid);methyl 2-phenylacetate has a molecular weight of 426.56 g/mol, XLogP of 4.92, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzenecarbothioic S-acid);methyl 2-phenylacetate is sourced from PubChem (CID 87890916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).