C16H18N2 — CID 67744417
1,4-diphenylbut-2-ene-2,3-diamine (PubChem CID 67744417) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,4-diphenylbut-2-ene-2,3-diamine.
| Compound Name | 1,4-diphenylbut-2-ene-2,3-diamine |
|---|---|
| PubChem CID | 67744417 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1,4-diphenylbut-2-ene-2,3-diamine |
| SMILES | NC(Cc1ccccc1)=C(N)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2/c17-15(11-13-7-3-1-4-8-13)16(18)12-14-9-5-2-6-10-14/h1-10H,11-12,17-18H2 |
| InChIKey | CKJOHEAQEIBCDX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |