C20H22N2 — CID 14933759
(2Z,4E,6Z)-1,8-diphenylocta-2,4,6-triene-2,7-diamine (PubChem CID 14933759) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2Z,4E,6Z)-1,8-diphenylocta-2,4,6-triene-2,7-diamine.
| Compound Name | (2Z,4E,6Z)-1,8-diphenylocta-2,4,6-triene-2,7-diamine |
|---|---|
| PubChem CID | 14933759 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (2Z,4E,6Z)-1,8-diphenylocta-2,4,6-triene-2,7-diamine |
| SMILES | N/C(=C\C=C\C=C(/N)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2/c21-19(15-17-9-3-1-4-10-17)13-7-8-14-20(22)16-18-11-5-2-6-12-18/h1-14H,15-16,21-22H2/b8-7+,19-13-,20-14- |
| InChIKey | AKLFCPNVQZPUSX-GUMFOZBPSA-N |
| XLogP | 3.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|