About 2-benzyl-3-phenylprop-1-ene-1,1-diamine
2-benzyl-3-phenylprop-1-ene-1,1-diamine (PubChem CID 23499817) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-benzyl-3-phenylprop-1-ene-1,1-diamine.
Molecular Properties
| Compound Name | 2-benzyl-3-phenylprop-1-ene-1,1-diamine |
| PubChem CID | 23499817 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-benzyl-3-phenylprop-1-ene-1,1-diamine |
| SMILES | NC(N)=C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2/c17-16(18)15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12,17-18H2 |
| InChIKey | GYNUVTRGMDMQQM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-3-phenylprop-1-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3-phenylprop-1-ene-1,1-diamine?
The IUPAC name of 2-benzyl-3-phenylprop-1-ene-1,1-diamine (CID 23499817) is 2-benzyl-3-phenylprop-1-ene-1,1-diamine.
What is the SMILES notation for 2-benzyl-3-phenylprop-1-ene-1,1-diamine?
The canonical SMILES for 2-benzyl-3-phenylprop-1-ene-1,1-diamine is NC(N)=C(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 2-benzyl-3-phenylprop-1-ene-1,1-diamine?
The InChIKey is GYNUVTRGMDMQQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2/c17-16(18)15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12,17-18H2.
What are the key properties of 2-benzyl-3-phenylprop-1-ene-1,1-diamine?
2-benzyl-3-phenylprop-1-ene-1,1-diamine has a molecular weight of 238.33 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-phenylprop-1-ene-1,1-diamine is sourced from PubChem (CID 23499817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).