C17H18N2O2 — CID 2888204
[[amino-(3-methylphenyl)methylidene]amino] 3-phenylpropanoate (PubChem CID 2888204) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is [[amino-(3-methylphenyl)methylidene]amino] 3-phenylpropanoate.
| Compound Name | [[amino-(3-methylphenyl)methylidene]amino] 3-phenylpropanoate |
|---|---|
| PubChem CID | 2888204 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [[amino-(3-methylphenyl)methylidene]amino] 3-phenylpropanoate |
| SMILES | Cc1cccc(C(N)=NOC(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O2/c1-13-6-5-9-15(12-13)17(18)19-21-16(20)11-10-14-7-3-2-4-8-14/h2-9,12H,10-11H2,1H3,(H2,18,19) |
| InChIKey | YZQZHGNONFWXCD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|