C15H15N3O2 — CID 71329912
[[amino-(3-methylphenyl)methylidene]amino] N-phenylcarbamate (PubChem CID 71329912) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is [[amino-(3-methylphenyl)methylidene]amino] N-phenylcarbamate.
| Compound Name | [[amino-(3-methylphenyl)methylidene]amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 71329912 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [[amino-(3-methylphenyl)methylidene]amino] N-phenylcarbamate |
| SMILES | Cc1cccc(C(N)=NOC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C15H15N3O2/c1-11-6-5-7-12(10-11)14(16)18-20-15(19)17-13-8-3-2-4-9-13/h2-10H,1H3,(H2,16,18)(H,17,19) |
| InChIKey | AYWJHDHJRNJZFF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|