About ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene
ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene (PubChem CID 143457159) has the molecular formula C19H32N4
and a molecular weight of 316.49 g/mol. Its IUPAC name is ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene.
Molecular Properties
| Compound Name | ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene |
| PubChem CID | 143457159 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene |
| SMILES | CC.CC.Cc1cccc(/C(N)=N/NN)c1.Cc1ccccc1 |
| InChI | InChI=1S/C8H12N4.C7H8.2C2H6/c1-6-3-2-4-7(5-6)8(9)11-12-10;1-7-5-3-2-4-6-7;2*1-2/h2-5,12H,10H2,1H3,(H2,9,11);2-6H,1H3;2*1-2H3 |
| InChIKey | VIYRRVJNIZTTNE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene?
The IUPAC name of ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene (CID 143457159) is ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene.
What is the SMILES notation for ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene?
The canonical SMILES for ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene is CC.CC.Cc1cccc(/C(N)=N/NN)c1.Cc1ccccc1.
What is the InChIKey of ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene?
The InChIKey is VIYRRVJNIZTTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4.C7H8.2C2H6/c1-6-3-2-4-7(5-6)8(9)11-12-10;1-7-5-3-2-4-6-7;2*1-2/h2-5,12H,10H2,1H3,(H2,9,11);2-6H,1H3;2*1-2H3.
What are the key properties of ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene?
ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene has a molecular weight of 316.49 g/mol, XLogP of 4.13, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-hydrazinyl-3-methylbenzenecarboximidamide;toluene is sourced from PubChem (CID 143457159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).