About 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid
3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid (PubChem CID 162722030) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid |
| PubChem CID | 162722030 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid |
| SMILES | NN/N=C(\N)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H10N4O2/c9-7(11-12-10)5-2-1-3-6(4-5)8(13)14/h1-4,12H,10H2,(H2,9,11)(H,13,14) |
| InChIKey | PTUHKFBCBGVDIF-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid?
The IUPAC name of 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid (CID 162722030) is 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid.
What is the SMILES notation for 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid?
The canonical SMILES for 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid is NN/N=C(\N)c1cccc(C(=O)O)c1.
What is the InChIKey of 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid?
The InChIKey is PTUHKFBCBGVDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c9-7(11-12-10)5-2-1-3-6(4-5)8(13)14/h1-4,12H,10H2,(H2,9,11)(H,13,14).
What are the key properties of 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid?
3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid has a molecular weight of 194.19 g/mol, XLogP of -0.53, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-N'-hydrazinylcarbamimidoyl]benzoic acid is sourced from PubChem (CID 162722030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).