About 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid
3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid (PubChem CID 142953452) has the molecular formula C15H14N2O3
and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid |
| PubChem CID | 142953452 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid |
| SMILES | N/C(=N\OCc1ccccc1)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H14N2O3/c16-14(12-7-4-8-13(9-12)15(18)19)17-20-10-11-5-2-1-3-6-11/h1-9H,10H2,(H2,16,17)(H,18,19) |
| InChIKey | YJZIIOKANDJBLQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid?
The IUPAC name of 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid (CID 142953452) is 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid.
What is the SMILES notation for 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid?
The canonical SMILES for 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid is N/C(=N\OCc1ccccc1)c1cccc(C(=O)O)c1.
What is the InChIKey of 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid?
The InChIKey is YJZIIOKANDJBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3/c16-14(12-7-4-8-13(9-12)15(18)19)17-20-10-11-5-2-1-3-6-11/h1-9H,10H2,(H2,16,17)(H,18,19).
What are the key properties of 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid?
3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid has a molecular weight of 270.29 g/mol, XLogP of 2.22, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-N'-phenylmethoxycarbamimidoyl]benzoic acid is sourced from PubChem (CID 142953452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).