C19H22N2O3 — CID 142953494
3-[(Z)-N'-[[4-(2-methylpropyl)phenyl]methoxy]carbamimidoyl]benzoic acid (PubChem CID 142953494) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[(Z)-N'-[[4-(2-methylpropyl)phenyl]methoxy]carbamimidoyl]benzoic acid.
| Compound Name | 3-[(Z)-N'-[[4-(2-methylpropyl)phenyl]methoxy]carbamimidoyl]benzoic acid |
|---|---|
| PubChem CID | 142953494 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-[(Z)-N'-[[4-(2-methylpropyl)phenyl]methoxy]carbamimidoyl]benzoic acid |
| SMILES | CC(C)Cc1ccc(CO/N=C(\N)c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-13(2)10-14-6-8-15(9-7-14)12-24-21-18(20)16-4-3-5-17(11-16)19(22)23/h3-9,11,13H,10,12H2,1-2H3,(H2,20,21)(H,22,23) |
| InChIKey | LOONHUDMUXUUMS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|