C19H18O6 — CID 70522984
benzene-1,3-dicarboxylic acid;benzyl 2-methylprop-2-enoate (PubChem CID 70522984) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;benzyl 2-methylprop-2-enoate.
| Compound Name | benzene-1,3-dicarboxylic acid;benzyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70522984 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;benzyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccccc1.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C11H12O2.C8H6O4/c1-9(2)11(12)13-8-10-6-4-3-5-7-10;9-7(10)5-2-1-3-6(4-5)8(11)12/h3-7H,1,8H2,2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | FJLKRRDGLRPDAH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|