About [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate
[[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate (PubChem CID 2890192) has the molecular formula C15H13BrN2O2
and a molecular weight of 333.19 g/mol. Its IUPAC name is [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate.
Molecular Properties
| Compound Name | [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate |
| PubChem CID | 2890192 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate |
| SMILES | Cc1cccc(C(N)=NOC(=O)c2ccccc2Br)c1 |
| InChI | InChI=1S/C15H13BrN2O2/c1-10-5-4-6-11(9-10)14(17)18-20-15(19)12-7-2-3-8-13(12)16/h2-9H,1H3,(H2,17,18) |
| InChIKey | YWZDFZMKMFEXOQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate?
The IUPAC name of [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate (CID 2890192) is [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate.
What is the SMILES notation for [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate?
The canonical SMILES for [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate is Cc1cccc(C(N)=NOC(=O)c2ccccc2Br)c1.
What is the InChIKey of [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate?
The InChIKey is YWZDFZMKMFEXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN2O2/c1-10-5-4-6-11(9-10)14(17)18-20-15(19)12-7-2-3-8-13(12)16/h2-9H,1H3,(H2,17,18).
What are the key properties of [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate?
[[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate has a molecular weight of 333.19 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(3-methylphenyl)methylidene]amino] 2-bromobenzoate is sourced from PubChem (CID 2890192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).