C16H16N2O2 — CID 2952842
[[amino(phenyl)methylidene]amino] 2,5-dimethylbenzoate (PubChem CID 2952842) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is [[amino(phenyl)methylidene]amino] 2,5-dimethylbenzoate.
| Compound Name | [[amino(phenyl)methylidene]amino] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 2952842 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [[amino(phenyl)methylidene]amino] 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)ON=C(N)c2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O2/c1-11-8-9-12(2)14(10-11)16(19)20-18-15(17)13-6-4-3-5-7-13/h3-10H,1-2H3,(H2,17,18) |
| InChIKey | BAPQOXTUNCXSNO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|