About [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate
[[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate (PubChem CID 58767880) has the molecular formula C22H18N4O4
and a molecular weight of 402.41 g/mol. Its IUPAC name is [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate.
Molecular Properties
| Compound Name | [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate |
| PubChem CID | 58767880 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate |
| SMILES | NC(=NOC(=O)c1ccccc1)c1ccc(C(N)=NOC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N4O4/c23-19(25-29-21(27)17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(24)26-30-22(28)18-9-5-2-6-10-18/h1-14H,(H2,23,25)(H2,24,26) |
| InChIKey | ZBANKJOXCNTFJS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate?
The IUPAC name of [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate (CID 58767880) is [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate.
What is the SMILES notation for [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate?
The canonical SMILES for [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate is NC(=NOC(=O)c1ccccc1)c1ccc(C(N)=NOC(=O)c2ccccc2)cc1.
What is the InChIKey of [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate?
The InChIKey is ZBANKJOXCNTFJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O4/c23-19(25-29-21(27)17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(24)26-30-22(28)18-9-5-2-6-10-18/h1-14H,(H2,23,25)(H2,24,26).
What are the key properties of [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate?
[[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate has a molecular weight of 402.41 g/mol, XLogP of 2.64, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylidene]amino] benzoate is sourced from PubChem (CID 58767880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).