C16H16N2O4 — CID 40528949
[(E)-[amino(phenyl)methylidene]amino] 3,5-dimethoxybenzoate (PubChem CID 40528949) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is [(E)-[amino(phenyl)methylidene]amino] 3,5-dimethoxybenzoate.
| Compound Name | [(E)-[amino(phenyl)methylidene]amino] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 40528949 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [(E)-[amino(phenyl)methylidene]amino] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)O/N=C(/N)c2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O4/c1-20-13-8-12(9-14(10-13)21-2)16(19)22-18-15(17)11-6-4-3-5-7-11/h3-10H,1-2H3,(H2,17,18) |
| InChIKey | DEGSFXDPNAXMBA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|