About [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate
[(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate (PubChem CID 5349115) has the molecular formula C15H13IN2O3
and a molecular weight of 396.18 g/mol. Its IUPAC name is [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate.
Molecular Properties
| Compound Name | [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate |
| PubChem CID | 5349115 |
| Molecular Formula | C15H13IN2O3 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate |
| SMILES | COc1ccc(/C(N)=N/OC(=O)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C15H13IN2O3/c1-20-13-8-4-10(5-9-13)14(17)18-21-15(19)11-2-6-12(16)7-3-11/h2-9H,1H3,(H2,17,18) |
| InChIKey | DFFZEVDURIKCPP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate?
The IUPAC name of [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate (CID 5349115) is [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate.
What is the SMILES notation for [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate?
The canonical SMILES for [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate is COc1ccc(/C(N)=N/OC(=O)c2ccc(I)cc2)cc1.
What is the InChIKey of [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate?
The InChIKey is DFFZEVDURIKCPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13IN2O3/c1-20-13-8-4-10(5-9-13)14(17)18-21-15(19)11-2-6-12(16)7-3-11/h2-9H,1H3,(H2,17,18).
What are the key properties of [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate?
[(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate has a molecular weight of 396.18 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 4-iodobenzoate is sourced from PubChem (CID 5349115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).