C18H20N2O6 — CID 46500526
[(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 2,4,5-trimethoxybenzoate (PubChem CID 46500526) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 2,4,5-trimethoxybenzoate.
| Compound Name | [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 46500526 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [(Z)-[amino-(4-methoxyphenyl)methylidene]amino] 2,4,5-trimethoxybenzoate |
| SMILES | COc1ccc(/C(N)=N/OC(=O)c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C18H20N2O6/c1-22-12-7-5-11(6-8-12)17(19)20-26-18(21)13-9-15(24-3)16(25-4)10-14(13)23-2/h5-10H,1-4H3,(H2,19,20) |
| InChIKey | YSRZFFNRLSSYPZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|