C14H11Cl2N3O3 — CID 2800140
[[amino-(4-methoxyphenyl)methylidene]amino] 2,5-dichloropyridine-3-carboxylate (PubChem CID 2800140) has the molecular formula C14H11Cl2N3O3 and a molecular weight of 340.17 g/mol. Its IUPAC name is [[amino-(4-methoxyphenyl)methylidene]amino] 2,5-dichloropyridine-3-carboxylate.
| Compound Name | [[amino-(4-methoxyphenyl)methylidene]amino] 2,5-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2800140 |
| Molecular Formula | C14H11Cl2N3O3 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | [[amino-(4-methoxyphenyl)methylidene]amino] 2,5-dichloropyridine-3-carboxylate |
| SMILES | COc1ccc(C(N)=NOC(=O)c2cc(Cl)cnc2Cl)cc1 |
| InChI | InChI=1S/C14H11Cl2N3O3/c1-21-10-4-2-8(3-5-10)13(17)19-22-14(20)11-6-9(15)7-18-12(11)16/h2-7H,1H3,(H2,17,19) |
| InChIKey | PLQWJPIMRPCHOE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|