C19H12Cl3N3O3 — CID 2746727
[[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-chlorobenzoate (PubChem CID 2746727) has the molecular formula C19H12Cl3N3O3 and a molecular weight of 436.68 g/mol. Its IUPAC name is [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-chlorobenzoate.
| Compound Name | [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2746727 |
| Molecular Formula | C19H12Cl3N3O3 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-chlorobenzoate |
| SMILES | NC(=NOC(=O)c1ccc(Cl)cc1)c1ccc(Oc2c(Cl)cncc2Cl)cc1 |
| InChI | InChI=1S/C19H12Cl3N3O3/c20-13-5-1-12(2-6-13)19(26)28-25-18(23)11-3-7-14(8-4-11)27-17-15(21)9-24-10-16(17)22/h1-10H,(H2,23,25) |
| InChIKey | RQZMQRSHEZSSES-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|