C20H17ClN2O3 — CID 73398027
[[amino-(4-chlorophenyl)methylidene]amino] 3-ethoxynaphthalene-2-carboxylate (PubChem CID 73398027) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is [[amino-(4-chlorophenyl)methylidene]amino] 3-ethoxynaphthalene-2-carboxylate.
| Compound Name | [[amino-(4-chlorophenyl)methylidene]amino] 3-ethoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 73398027 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [[amino-(4-chlorophenyl)methylidene]amino] 3-ethoxynaphthalene-2-carboxylate |
| SMILES | CCOc1cc2ccccc2cc1C(=O)ON=C(N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O3/c1-2-25-18-12-15-6-4-3-5-14(15)11-17(18)20(24)26-23-19(22)13-7-9-16(21)10-8-13/h3-12H,2H2,1H3,(H2,22,23) |
| InChIKey | HUEUAOIKBOMCKX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|