C14H8Cl2F3N3O2 — CID 2781950
[[amino-[3-(trifluoromethyl)phenyl]methylidene]amino] 2,5-dichloropyridine-3-carboxylate (PubChem CID 2781950) has the molecular formula C14H8Cl2F3N3O2 and a molecular weight of 378.14 g/mol. Its IUPAC name is [[amino-[3-(trifluoromethyl)phenyl]methylidene]amino] 2,5-dichloropyridine-3-carboxylate.
| Compound Name | [[amino-[3-(trifluoromethyl)phenyl]methylidene]amino] 2,5-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2781950 |
| Molecular Formula | C14H8Cl2F3N3O2 |
| Molecular Weight | 378.14 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | [[amino-[3-(trifluoromethyl)phenyl]methylidene]amino] 2,5-dichloropyridine-3-carboxylate |
| SMILES | NC(=NOC(=O)c1cc(Cl)cnc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8Cl2F3N3O2/c15-9-5-10(11(16)21-6-9)13(23)24-22-12(20)7-2-1-3-8(4-7)14(17,18)19/h1-6H,(H2,20,22) |
| InChIKey | DURAXJMRNRXJOK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|