C14H10ClF3N2O — CID 102979678
N-(2-chloro-5-methyl-3-pyridinyl)-3-(trifluoromethyl)benzamide (PubChem CID 102979678) has the molecular formula C14H10ClF3N2O and a molecular weight of 314.69 g/mol. Its IUPAC name is N-(2-chloro-5-methyl-3-pyridinyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(2-chloro-5-methyl-3-pyridinyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 102979678 |
| Molecular Formula | C14H10ClF3N2O |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N-(2-chloro-5-methyl-3-pyridinyl)-3-(trifluoromethyl)benzamide |
| SMILES | Cc1cnc(Cl)c(NC(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C14H10ClF3N2O/c1-8-5-11(12(15)19-7-8)20-13(21)9-3-2-4-10(6-9)14(16,17)18/h2-7H,1H3,(H,20,21) |
| InChIKey | ZXNHQIULXOFLMV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|