C20H12ClF4N3O2 — CID 174537026
N-(5-benzamido-6-chloro-3-pyridinyl)-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 174537026) has the molecular formula C20H12ClF4N3O2 and a molecular weight of 437.78 g/mol. Its IUPAC name is N-(5-benzamido-6-chloro-3-pyridinyl)-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-(5-benzamido-6-chloro-3-pyridinyl)-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174537026 |
| Molecular Formula | C20H12ClF4N3O2 |
| Molecular Weight | 437.78 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-(5-benzamido-6-chloro-3-pyridinyl)-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cnc(Cl)c(NC(=O)c2ccccc2)c1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12ClF4N3O2/c21-17-16(28-18(29)11-4-2-1-3-5-11)9-15(10-26-17)27-19(30)12-6-13(20(23,24)25)8-14(22)7-12/h1-10H,(H,27,30)(H,28,29) |
| InChIKey | JGPZUGQXEDQREP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.78 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|