C13H9F4N3O — CID 82792233
3-amino-5-fluoro-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide (PubChem CID 82792233) has the molecular formula C13H9F4N3O and a molecular weight of 299.23 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide.
| Compound Name | 3-amino-5-fluoro-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 82792233 |
| Molecular Formula | C13H9F4N3O |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-amino-5-fluoro-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide |
| SMILES | Nc1cc(F)cc(C(=O)Nc2ccc(C(F)(F)F)nc2)c1 |
| InChI | InChI=1S/C13H9F4N3O/c14-8-3-7(4-9(18)5-8)12(21)20-10-1-2-11(19-6-10)13(15,16)17/h1-6H,18H2,(H,20,21) |
| InChIKey | QCRXWXHXAQOUOU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|