C13H9F3N2OS — CID 107033720
3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide (PubChem CID 107033720) has the molecular formula C13H9F3N2OS and a molecular weight of 298.29 g/mol. Its IUPAC name is 3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide.
| Compound Name | 3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 107033720 |
| Molecular Formula | C13H9F3N2OS |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)nc1)c1cccc(S)c1 |
| InChI | InChI=1S/C13H9F3N2OS/c14-13(15,16)11-5-4-9(7-17-11)18-12(19)8-2-1-3-10(20)6-8/h1-7,20H,(H,18,19) |
| InChIKey | RUXUVDFASHVMQO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|