C13H8F4N2OS — CID 107033712
4-fluoro-3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide (PubChem CID 107033712) has the molecular formula C13H8F4N2OS and a molecular weight of 316.28 g/mol. Its IUPAC name is 4-fluoro-3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide.
| Compound Name | 4-fluoro-3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 107033712 |
| Molecular Formula | C13H8F4N2OS |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-fluoro-3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)nc1)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C13H8F4N2OS/c14-9-3-1-7(5-10(9)21)12(20)19-8-2-4-11(18-6-8)13(15,16)17/h1-6,21H,(H,19,20) |
| InChIKey | NSWDJQYFMNNBMF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|