C15H11F4N3O2 — CID 166822202
N-[3-(carbamoylamino)phenyl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 166822202) has the molecular formula C15H11F4N3O2 and a molecular weight of 341.26 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(carbamoylamino)phenyl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166822202 |
| Molecular Formula | C15H11F4N3O2 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | NC(=O)Nc1cccc(NC(=O)c2cc(F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H11F4N3O2/c16-10-5-8(4-9(6-10)15(17,18)19)13(23)21-11-2-1-3-12(7-11)22-14(20)24/h1-7H,(H,21,23)(H3,20,22,24) |
| InChIKey | ASSXMAZVHRWDES-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |