About 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide
3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide (PubChem CID 4269086) has the molecular formula C15H10F6N2
and a molecular weight of 332.25 g/mol. Its IUPAC name is 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide |
| PubChem CID | 4269086 |
| Molecular Formula | C15H10F6N2 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide |
| SMILES | N/C(=N\c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F6N2/c16-14(17,18)10-4-1-3-9(7-10)13(22)23-12-6-2-5-11(8-12)15(19,20)21/h1-8H,(H2,22,23) |
| InChIKey | YVIRBKVHDITBNP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide?
The IUPAC name of 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide (CID 4269086) is 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide.
What is the SMILES notation for 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide?
The canonical SMILES for 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide is N/C(=N\c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide?
The InChIKey is YVIRBKVHDITBNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F6N2/c16-14(17,18)10-4-1-3-9(7-10)13(22)23-12-6-2-5-11(8-12)15(19,20)21/h1-8H,(H2,22,23).
What are the key properties of 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide?
3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide has a molecular weight of 332.25 g/mol, XLogP of 4.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-N'-[3-(trifluoromethyl)phenyl]benzenecarboximidamide is sourced from PubChem (CID 4269086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).