C11H11F3N2S — CID 143118268
[(E)-prop-1-enyl] N'-[3-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 143118268) has the molecular formula C11H11F3N2S and a molecular weight of 260.28 g/mol. Its IUPAC name is [(E)-prop-1-enyl] N'-[3-(trifluoromethyl)phenyl]carbamimidothioate.
| Compound Name | [(E)-prop-1-enyl] N'-[3-(trifluoromethyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 143118268 |
| Molecular Formula | C11H11F3N2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | [(E)-prop-1-enyl] N'-[3-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | C/C=C/S/C(N)=N/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N2S/c1-2-6-17-10(15)16-9-5-3-4-8(7-9)11(12,13)14/h2-7H,1H3,(H2,15,16)/b6-2+ |
| InChIKey | NKZKZKOHKLVOKY-QHHAFSJGSA-N |
| XLogP | 3.92 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|