C11H9F5 — CID 144854225
1-[(E)-1,1-difluorobut-2-enyl]-3-(trifluoromethyl)benzene (PubChem CID 144854225) has the molecular formula C11H9F5 and a molecular weight of 236.18 g/mol. Its IUPAC name is 1-[(E)-1,1-difluorobut-2-enyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[(E)-1,1-difluorobut-2-enyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 144854225 |
| Molecular Formula | C11H9F5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-[(E)-1,1-difluorobut-2-enyl]-3-(trifluoromethyl)benzene |
| SMILES | C/C=C/C(F)(F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F5/c1-2-6-10(12,13)8-4-3-5-9(7-8)11(14,15)16/h2-7H,1H3/b6-2+ |
| InChIKey | YIPMCRCNBNRPNO-QHHAFSJGSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|