C30H18F12O2 — CID 3857608
1,1,2,2-tetrakis[3-(trifluoromethyl)phenyl]ethane-1,2-diol (PubChem CID 3857608) has the molecular formula C30H18F12O2 and a molecular weight of 638.45 g/mol. Its IUPAC name is 1,1,2,2-tetrakis[3-(trifluoromethyl)phenyl]ethane-1,2-diol.
| Compound Name | 1,1,2,2-tetrakis[3-(trifluoromethyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 3857608 |
| Molecular Formula | C30H18F12O2 |
| Molecular Weight | 638.45 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | 1,1,2,2-tetrakis[3-(trifluoromethyl)phenyl]ethane-1,2-diol |
| SMILES | OC(c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)C(O)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H18F12O2/c31-27(32,33)21-9-1-5-17(13-21)25(43,18-6-2-10-22(14-18)28(34,35)36)26(44,19-7-3-11-23(15-19)29(37,38)39)20-8-4-12-24(16-20)30(40,41)42/h1-16,43-44H |
| InChIKey | UHKNZEHXAJSNBP-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.45 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |