C10H6F8O2 — CID 140557500
1,2,2,2-tetrafluoro-1-[3-(1,2,2,2-tetrafluoro-1-hydroxyethyl)phenyl]ethanol (PubChem CID 140557500) has the molecular formula C10H6F8O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is 1,2,2,2-tetrafluoro-1-[3-(1,2,2,2-tetrafluoro-1-hydroxyethyl)phenyl]ethanol.
| Compound Name | 1,2,2,2-tetrafluoro-1-[3-(1,2,2,2-tetrafluoro-1-hydroxyethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 140557500 |
| Molecular Formula | C10H6F8O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1,2,2,2-tetrafluoro-1-[3-(1,2,2,2-tetrafluoro-1-hydroxyethyl)phenyl]ethanol |
| SMILES | OC(F)(c1cccc(C(O)(F)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C10H6F8O2/c11-7(19,9(13,14)15)5-2-1-3-6(4-5)8(12,20)10(16,17)18/h1-4,19-20H |
| InChIKey | UUFRMNLSUWQWCU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |