C18H14F12O6 — CID 86739459
1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propan-2-ol;bis(prop-2-enoic acid) (PubChem CID 86739459) has the molecular formula C18H14F12O6 and a molecular weight of 554.28 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propan-2-ol;bis(prop-2-enoic acid).
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propan-2-ol;bis(prop-2-enoic acid) |
|---|---|
| PubChem CID | 86739459 |
| Molecular Formula | C18H14F12O6 |
| Molecular Weight | 554.28 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propan-2-ol;bis(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.OC(c1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H6F12O2.2C3H4O2/c13-9(14,15)7(25,10(16,17)18)5-2-1-3-6(4-5)8(26,11(19,20)21)12(22,23)24;2*1-2-3(4)5/h1-4,25-26H;2*2H,1H2,(H,4,5) |
| InChIKey | HCPDBPITRBPGGI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|