C12H12F6O — CID 20728974
1,1,1,3,3,3-hexafluoro-2-(3-propylphenyl)propan-2-ol (PubChem CID 20728974) has the molecular formula C12H12F6O and a molecular weight of 286.22 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(3-propylphenyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(3-propylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 20728974 |
| Molecular Formula | C12H12F6O |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(3-propylphenyl)propan-2-ol |
| SMILES | CCCc1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6O/c1-2-4-8-5-3-6-9(7-8)10(19,11(13,14)15)12(16,17)18/h3,5-7,19H,2,4H2,1H3 |
| InChIKey | IBZZXPYMJGNAIN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |